111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
90-05-1 |
EC NO: |
201-964-7 |
Molecular Formula: |
C7H8O2 |
Molecular Weight: |
124.13 |
Specification: |
|
InChI: |
InChI=1/C7H8O2/c1-9-7-5-3-2-4-6(7)8/h2-5,8H,1H3 |
Product description:
Colorless to faintly yellowish liquid or white or slightly yellow crystalline mass, darkens on exposure to air or light, characteristic sweet, slightly phenolic odor.Local anesthetic agent. |
Synonyms: |
2-Methoxyphenol/Guaiacol;GAIACOL;o-Methoxyphenol;o-Hydroxyanisole;2-Methoxyphenol;Catechol monomethyl ether;Guaiaco;1-Hydroxy-2-methoxybenzene;a-methoxyphenolsalicyl methyl ether |
Molecular Structure: |
 |