111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
621-59-0 |
EC NO: |
210-694-9 |
Molecular Formula: |
C8H8O3 |
Molecular Weight: |
152.1473 |
Specification: |
|
InChI: |
InChI=1/C8H8O3/c1-11-8-3-2-6(5-9)4-7(8)10/h2-5,10H,1H3 |
Product description:
White to tan to pink powder.Clean up spills immediately, using the appropriate protective equipment. Sweep up or absorb material, then place into a suitable clean, dry, closed container for disposal. Provide ventilation. |
Synonyms: |
Isovanillin;3-Hydroxy-p-anisaldehyde;3-Hydorxy-4-Methoxy Benzoic Acid;ISOVANILIN;4-METHOXY-3-HYDROXYBENZALDEHYDE;3-HYDROXY-4-ANISALDEHYDE;3-HYDROXYANISALDEHYDE;AKOS B022473; |
Molecular Structure: |
 |