Details for DL-Alanine Methyl Ester Hydrochloride

DL-Alanine Methyl Ester Hydrochloride
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
13515-97-4 |
EC NO: |
236-854-8 |
Molecular Formula: |
C4H10ClNO2 |
Molecular Weight: |
139.5807 |
Specification: |
|
InChI: |
InChI=1/C4H9NO2.ClH/c1-3(5)4(6)7-2;/h3H,5H2,1-2H3;1H |
Synonyms: |
DL-alanine methyl ester hcl;methyl L-alaninate hydrochloride;methyl alaninate hydrochloride;Methyl Dl-2-Aminopropanoate Hydrochloride;H-DL-Ala-OMe¡¤HCl;H-DL-Ala-OMe•HCl; |
Molecular Structure: |
 |
if you are sourcing DL-Alanine Methyl Ester Hydrochloride from United-States ,just feel free to inquire