Details for Heptyl Phenyl Ketone

Heptyl Phenyl Ketone
111Category: |
Organic chemicals and Derivatives/Aroma compounds |
|
CAS NO: |
1674-37-9 |
EC NO: |
216-817-2 |
Molecular Formula: |
C14H20O |
Molecular Weight: |
204.308 |
Specification: |
|
InChI: |
InChI=1/C14H20O/c1-2-3-4-5-9-12-14(15)13-10-7-6-8-11-13/h6-8,10-11H,2-5,9,12H2,1H3 |
Synonyms: |
1-Octanone, 1-phenyl-;Caprylophenone;Heptyl phenyl ketone;Ketone, heptyl phenyl;NSC 22009;Octanophenone;1-Phenyloctan-1-one;N-octanophenone; |
Molecular Structure: |
 |
if you are sourcing Heptyl Phenyl Ketone from United-States ,just feel free to inquire