Details for Monomethyl Glutarate
Monomethyl Glutarate
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
1501-27-5 |
EC NO: |
216-116-1 |
Molecular Formula: |
C15H26O4 |
Molecular Weight: |
270.3645 |
Specification: |
|
InChI: |
InChI=1/C15H26O4/c1-10(2)12-8-7-11(3)9-13(12)19-15(18)6-4-5-14(16)17/h10-13H,4-9H2,1-3H3,(H,16,17) |
Synonyms: |
Methyl hydrogen glutarate;Glutaric acid monomethyl ester;Monomethyl glutarate;Pentanedioic acid monomethyl ester;Monoethyl Glutaric Acid;5-methoxy-5-oxopentanoic acid;5-methoxy-5-oxopentanoate;5-{[5-methyl-2-(propan-2-yl)cyclohexyl]oxy}-5-oxopentanoic acid; |
Molecular Structure: |
|
if you are sourcing Monomethyl Glutarate from United-States ,just feel free to inquire