Details for N-CBZ-Glycine Methyl Ester
N-CBZ-Glycine Methyl Ester
111Category: |
Organic chemicals and Derivatives |
|
CAS NO: |
1212-53-9 |
EC NO: |
214-922-8 |
Molecular Formula: |
C11H13NO4 |
Molecular Weight: |
223.2252 |
Specification: |
|
InChI: |
InChI=1/C11H13NO4/c1-15-10(13)7-12-11(14)16-8-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,12,14) |
Synonyms: |
Carbobenzyloxyglycine Methyl Ester;N-CBZ-Glycine Methyl Ester;methyl glycinate;CBZ-Glycine methyl ester;Z-Gly-Ome;Z-Gly-OMe; |
Molecular Structure: |
|
if you are sourcing N-CBZ-Glycine Methyl Ester from United-States ,just feel free to inquire