Details for 4-hydroxymandelic acid

4-hydroxymandelic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
7198-10-9 |
EC NO: |
214-839-7 |
Molecular Formula: |
C8H7O4 |
Molecular Weight: |
167.1393 |
Specification: |
|
InChI: |
InChI=1/C8H8O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12)/p-1/t7-/m0/s1 |
Synonyms: |
P-hydroxy mandelic acid;4-Hydroxymandelic acid;hydroxy(4-hydroxyphenyl)acetic acid;(2R)-hydroxy(4-hydroxyphenyl)ethanoate;(2S)-hydroxy(4-hydroxyphenyl)ethanoate;4-Hydroxyphenylglycolic acid;p-Hydroxymandelic acid; |
Molecular Structure: |
 |
if you are sourcing 4-hydroxymandelic acid from China ,just feel free to inquire