Details for 3-Nitro-2-Methyl benzoic acid

3-Nitro-2-Methyl benzoic acid
111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
1975-50-4 |
EC NO: |
217-826-4 |
Molecular Formula: |
C8H6NO4 |
Molecular Weight: |
180.1381 |
Specification: |
|
InChI: |
InChI=1/C8H7NO4/c1-5-6(8(10)11)3-2-4-7(5)9(12)13/h2-4H,1H3,(H,10,11)/p-1 |
Synonyms: |
3-Nitro-o-toluic acid;3-Nitro-2-Methyl Benzoic Acid;2-methyl-3-nitrobenzoate;2-Methyl-3-nitro benzoic acid; |
Molecular Structure: |
 |
if you are sourcing 3-Nitro-2-Methyl benzoic acid from China ,just feel free to inquire