Details for Styralyl Acetate
![](/images/home/newal1.gif)
Styralyl Acetate
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
93-92-5 |
EC NO: |
202-288-5 |
Molecular Formula: |
C10H12O2 |
Molecular Weight: |
164.2011 |
Specification: |
|
InChI: |
InChI=1/C10H12O2/c1-8(12-9(2)11)10-6-4-3-5-7-10/h3-8H,1-2H3/t8-/m1/s1 |
Synonyms: |
alpha-Methylbenzyl acetate;Methyl phenylcarbinyl acetate;1-phenylethyl acetate;(1S)-1-phenylethyl acetate;(1R)-1-phenylethyl acetate;1-Hydroxy-1-phenylethyl acetate;Styrallyl Acetate; |
Molecular Structure: |
![Styralyl Acetate 93-92-5](https://images-a.chemnet.com/suppliers/chembase/cas8/cas93-92-5.gif) |
if you are sourcing Styralyl Acetate from China ,just feel free to inquire