Details for Valeric Acid
![](/images/home/newal1.gif)
Valeric Acid
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
109-52-4 |
EC NO: |
203-677-2 |
Molecular Formula: |
C5H10O2 |
Molecular Weight: |
102.1317 |
Specification: |
|
InChI: |
InChI=1/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7) |
Synonyms: |
1-butanecarboxylic acid;Butanecarboxylic Acid;n-Pentanoic Acid;valerianic acid;VALERIC ACOD;Valeric acid;propylacetic acid;N-Pentanoic;3-(methylsulfanyl)propanoic acid;pentanoic acid; |
Molecular Structure: |
![Valeric Acid 109-52-4](https://images-a.chemnet.com/suppliers/chembase/140/140970_1.gif) |
if you are sourcing Valeric Acid from China ,just feel free to inquire