111Category: |
Organic chemicals and Derivatives/Acid, ester and anhydride compounds |
|
CAS NO: |
138-22-7 |
EC NO: |
205-316-4;252-036-3 |
Molecular Formula: |
C7H14O3 |
Molecular Weight: |
146.1843 |
Specification: |
|
InChI: |
InChI=1/C7H14O3/c1-3-4-5-10-7(9)6(2)8/h6,8H,3-5H2,1-2H3/t6-/m0/s1 |
Product description:
Density: |
1.005g/cm3 |
Melting Point(℃): |
-43℃ |
Boiling Point(℃): |
189.4°C at 760 mmHg |
Flash Point(℃): |
71°C |
refractive_index: |
1.432 |
Water Solubility: |
42 g/L (25℃) |
|
Synonyms: |
2-Propanoic Acid;Butyl 2-hydroxypropanoate;Butyl alpha-Hydroxypropionate;Butyl Lactate;Lactic Acid Butyl Ester; ;butyl (2R)-2-hydroxypropanoate;butyl (2S)-2-hydroxypropanoate;(-)-butyl L-lactate;n-Butyl (S)-(-)-2-hydroxypropionate;L-Lactic acid n-butyl ester;(R)-(-)-Butyllactat;Butyl L-Lactate; |
Molecular Structure: |
 |