Details for Phenyl Ethyl Phenyl Acetate
Phenyl Ethyl Phenyl Acetate
111Category: |
Fragrances and Aroma chemicals |
|
CAS NO: |
102-20-5 |
EC NO: |
203-013-1 |
Molecular Formula: |
C16H16O2 |
Molecular Weight: |
240.297 |
Specification: |
|
InChI: |
InChI=1/C16H16O2/c17-16(13-15-9-5-2-6-10-15)18-12-11-14-7-3-1-4-8-14/h1-10H,11-13H2 |
Synonyms: |
2-Phenylethyl alpha-toluate;2-Phenylethyl phenyl acetate;Benzylcarbinyl alpha-toluate;Benzylcarbinyl phenyl acetate;FENILACETATO DE FENILETILO;Phenylacetic acid phenyl ethyl ester;Phenylethyl phenylacetate;2-phenylethyl phenylacetate; |
Molecular Structure: |
|
if you are sourcing Phenyl Ethyl Phenyl Acetate from India ,just feel free to inquire