111Category: |
Catalyst and Auxiliary/Water Treatment Chemicals |
|
CAS NO: |
95-14-7 |
EC NO: |
202-394-1 |
Molecular Formula: |
C6H5N3 |
Molecular Weight: |
119.12 |
Specification: |
|
InChI: |
InChI=1/C6H5N3/c1-2-4-6-5(3-1)7-9-8-6/h1-4H,(H,7,8,9) |
Uses: |
Utilized as a high-molecular stabilizer in rust preventive oils (greases), plant growth regulators, and lubricating oil additives. This product can also be combined with various scale inhibitors and bactericides/algicides for synergistic effects. |
Synonyms: |
1,2,3-benzotriazole;Benzotraizole;T406 petroleum additive;1,2,3-Benzotrialole;1,2,3-benzo triazole;BTA;benzotriazole;1,2,3-benzotriazole (BTA);benzotriazole (BTA);BTA (1H-Benzotriazole); |
Molecular Structure: |
 |