Details for 2-Ethylhexanoic Acid

2-Ethylhexanoic Acid
111Category: |
Other Chemicals |
|
CAS NO: |
149-57-5 |
EC NO: |
205-743-6 |
Molecular Formula: |
C8H15O2 |
Molecular Weight: |
143.204 |
Specification: |
|
InChI: |
InChI=1/C8H16O2/c1-3-5-6-7(4-2)8(9)10/h7H,3-6H2,1-2H3,(H,9,10)/p-1/t7-/m1/s1 |
Uses: |
It is primarily used in the preparation of various metal salts as driers for coatings and paints. Its esters can be used as plasticizers and as raw materials for carboxybenzyl penicillin. |
Synonyms: |
2-Ethylcapronic acid;2-ethylcaproic acid;2-methylpropanoic acid;(2S)-2-ethylhexanoate;(2R)-2-ethylhexanoate;Isocaprylic acid; |
Molecular Structure: |
 |
if you are sourcing 2-Ethylhexanoic Acid from China ,just feel free to inquire