Details for Triphenylphosphine
![](/images/home/newal1.gif)
Triphenylphosphine
111Category: |
Intermediates |
|
CAS NO: |
603-35-0 |
EC NO: |
210-036-0 |
Molecular Formula: |
C18H15P |
Molecular Weight: |
262.29 |
Specification: |
|
InChI: |
InChI=1/C18H15P.BrH/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H |
Uses: |
Utilized in organic synthesis, also serves as a polymerization initiator and a raw material for antibiotics like chloramphenicol. |
Synonyms: |
triphenyl phosphine;Triphenylphosphorus;triphenylphosphane hydrobromide (1:1);PPh3;triaryl phosphines;triarylphosphines;triphenyl phosphorous;trifenylfosfin;triphenylphosphane;triphenylphosphide;trifenylfosfin; |
Molecular Structure: |
![Triphenylphosphine 603-35-0](https://images-a.chemnet.com/suppliers/chembase/295/2951.gif) |
if you are sourcing Triphenylphosphine from China ,just feel free to inquire