Details for Glyoxylic acid methylester
Glyoxylic acid methylester
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
922-68-9 |
EC NO: |
213-084-0 |
Molecular Formula: |
C3H4O3 |
Molecular Weight: |
88.0621 |
Specification: |
|
InChI: |
InChI=1/C3H4O3/c1-6-3(5)2-4/h2H,1H3 |
Synonyms: |
GLYOXYLIC ACID METHYL ESTER;Acetic acid, oxo-, methyl ester;oxo-aceticacimethylester;2-(2-methyoxy phenoxy) ethylamine HCL;L-MENTHYL GLYOXYLATE HYDRATE ( MGH) STAGE I;2-(2-Methoxphenoxyl)ethylamine;Methyl 2-oxoacetate;methyl oxoacetate; |
Molecular Structure: |
|
if you are sourcing Glyoxylic acid methylester from Netherlands ,just feel free to inquire