Details for Glyoxylic acid methylester methylhemiacetal
![](/images/home/newal1.gif)
Glyoxylic acid methylester methylhemiacetal
111Category: |
Pharmaceuticals and Biochemicals |
|
CAS NO: |
19757-97-2 |
EC NO: |
243-271-2 |
Molecular Formula: |
C4H8O4 |
Molecular Weight: |
120.1039 |
Specification: |
|
InChI: |
InChI=1/C4H8O4/c1-7-3(5)4(6)8-2/h3,5H,1-2H3 |
Synonyms: |
2-Hydroxy-2-methoxyacetic acid methyl ester;Glyoxylic acid methylester methylhemiacetal;2-hydroxy-2-methoxy acetic acid methyl ester;methyl (hydroxymethoxy)acetate;Methyl 2-hydroxy-2-methoxyacetate;Methyl 2-hydroxy-2-methoxyacetate; |
Molecular Structure: |
![Glyoxylic acid methylester methylhemiacetal 19757-97-2](https://images-a.chemnet.com/suppliers/chembase/cas/cas19757-97-2.gif) |
if you are sourcing Glyoxylic acid methylester methylhemiacetal from Netherlands ,just feel free to inquire