year
111Category: | Pharmaceuticals and Biochemicals |
|
|
CAS NO: | 484-12-8 | ||
EC NO: | |||
Molecular Formula: | C15H16O3 | ||
Molecular Weight: | 244.2857 | ||
Specification: | 98% | ||
InChI: | InChI=1/C15H16O3/c1-10(2)4-7-12-13(17-3)8-5-11-6-9-14(16)18-15(11)12/h4-6,8-9H,7H2,1-3H3 | ||
Packing: | 25kg/drum | ||
Product description: Function: 1. Increase sperm secretion, stimulate sexual desire and has aphrodisiac action 2. Dry dampness and kills worms 3. Expel cold and expel the wind 4. Warm the kidney to strengthen yin 5. Relieve asthma 6. Antifungus, antivirus |
|||
Uses: | used in health food | ||
Synonyms: | Common Cnidium Fruit Extract;7-Methoxy-8-(3-methyl-2-butenyl)-2H-1-benzopyran-2-one;7-methoxy-8-(3-methylbut-2-en-1-yl)-2H-chromen-2-one;osthol; | ||
Molecular Structure: |