| Category: |
Paint and Coatings |
|
| CAS NO: |
126-30-7 |
| EC NO: |
204-781-0 |
| Molecular Formula: |
C5H12O2 |
| Molecular Weight: |
104.1476 |
| Specification: |
25kg |
| InChI: |
InChI=1/C5H12O2/c1-2-5(3-6)4-7/h5-7H,2-4H2,1H3 |
| Packing: |
bag |
Product description:
The products are used as plasticizers, surfactants, insulating materials, printing inks, polymerization inhibitors, synthetic aviation lubricant oil additives, etc. for synthetic unsaturated polyester resins, oil-free alkyd resins, polyurethane foam plastics and elastomers. |
| Uses: |
Analytically pure; Pharmaceutical raw materials; Biochemical reagents; Other oxygenated compounds; General purpose reagents; Alcohols; Organic blocks; High purity reagents; Other biochemical reagents; Other raw materials; Organic raw materials |
| Synonyms: |
Neopentyl glycol;2,2-dimethylpropane-1,3-diol;2-ethylpropane-1,3-diol;Neopentyl glycol(2,2-Dimethyl-1,3-propanediol); |
| Molecular Structure: |
 |