111Category: |
Other Chemicals |
|
CAS NO: |
69-72-7 |
EC NO: |
200-712-3 |
Molecular Formula: |
C7H6O3 |
Molecular Weight: |
138.12 |
Specification: |
|
InChI: |
InChI=1/C7H6O3/c8-6-4-2-1-3-5(6)7(9)10/h1-4,8H,(H,9,10) |
Uses: |
The pharmaceutical industry is used to make antipyretic, analgesic, anti-inflammatory, diuretic and other drugs, the dye industry is used to make azo direct dyes and acid mordant dyes, also used in spices and so on |
Synonyms: |
2-Hydroxybenzoic Acid;2-hydroxy benzoic acid;o-hydroxybenzoic acid;ortho-hydroxybenzoic acid;Sublimed Salicylic Acid;Medicinal Salicylic Acid;Medical Salicylic Acid;salicylic aicd; |
Molecular Structure: |
 |